Zirconium(IV) chloride tetrahydrofuran complex (1:2)
ALDRICH/395420 - 99%
Synonym: Tetrachlorobis(tetrahydrofuran)
CAS Number: 21959-01-3
Empirical Formula (Hill Notation): C8H16Cl4O2Zr
Molecular Weight: 377.25
MDL Number: MFCD00145367
Linear Formula: ZrCl4 · 2OC4H8
Product Type: Chemical
ATR-IR Spectra for Tetrachlorobis(tetrahydrofuran)zirconium.
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 395420-5G
| assay | 99% |
| form | powder |
| InChI | 1S/2C4H8O.4ClH.Zr/c2*1-2- |
| InChI key | VDJJKYYENYIHFF-UHFFFAOYSA |
| mp | 175-177 °C (lit.) |
| Quality Level | 100  |
| reaction suitability | core: zirconium |
| reagent type: catalyst | |
| SMILES string | Cl[Zr](Cl)(Cl)Cl.C1CCOC1. |
| storage temp. | 2-8°C |
| vapor pressure | 152 mmHg ( 25 °C)(lit.) |
| Packaging: | 5 g in glass bottle |
| Symbol |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H228 - H302 + H312 + H332 - H314 |
| Precautionary statements | P210 - P260 - P280 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | F,C |
| Risk Statements | 11-20/21/22-34 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 2925 8(4.1) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 175-177 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352302 |