Synonym: trans,trans-1-Chloro-3,7,11-trimethyl-2,6,10-dodecatriene
CAS Number: 67023-84-1
Empirical Formula (Hill Notation): C15H25Cl
Molecular Weight: 240.81
MDL Number: MFCD00192172
Linear Formula: (CH3)2C=CH[CH2CH2C(CH3)=CH]2CH2Cl
Product Type: Chemical
| assay |
97% |
| bp |
59-60 °C/2.4 mmHg (lit.) |
| density |
0.916 g/mL at 25 °C (lit.) |
| form |
liquid |
| InChI |
1S/C15H25Cl/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| InChI key |
BJVUJIDTICYHLL-YFVJMOTDSA-N |
| refractive index |
n20/D 1.493 (lit.) |
| SMILES string |
[H]C(CCl)=C(C)CCC([H])=C(/C)CCC([H])=C(/C)C |
| storage temp. |
2-8°C |
| Application: |
trans,trans-Farnesyl chloride (all-trans-farnesyl chloride) is suitable for use in the preparation of (S)-farnesyl thiopyrophosphate. |
| Application: |
Farnesyl chloride may be used in the synthesis of isoprenoid conjugates of nucleoside 5′-diphosphates. |
| General description: |
Physical properties (density, refractive index and boiling point) of trans,trans-farnesyl chloride have been reported. |
| Packaging: |
1, 5 g in glass bottle |
| Purity |
97% |
| bp |
59-60 °C/2.4 mmHg (lit.) |
| Density |
0.916 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.493 (lit.) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352100 |
GHS07