(−)-β-Pinene
ALDRICH/402753 - ≥99%
Synonym: (-)-beta-Pinene; (1S)-(−)-β-Pinene; (1S,5S)-2(10)-Pinene; (1S,5S)
CAS Number: 18172-67-3
Empirical Formula (Hill Notation): C10H16
Molecular Weight: 136.23
EC Number: 242-060-2
MDL Number: MFCD00001345
Linear Formula: C10H16
Product Type: Chemical
| assay | ≥99% |
| bp | 165-167 °C (lit.) |
| density | 0.866 g/mL at 25 °C |
| form | liquid |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9( |
| InChI key | WTARULDDTDQWMU-IUCAKERBSA |
| mp | −61 °C (lit.) |
| optical activity | [α]25/D −22°, neat |
| optical purity | ee: 97% (GLC) |
| refractive index | n |
| SMILES string | [H][C@]12CCC(=C)[C@]([H]) |
| vapor density | 4.7 (vs air) |
| vapor pressure | ~2 mmHg ( 20 °C) |
| Application: | (-)-β-Pinene has been used as a standard for the analysis of terpenoid compounds in plant essential oils by GC analysis. It may be used as a building block to synthesize natural products such as grandisol, robustadial and (+)-nopinone. (-)-β-Pinene undergoes hydroformylation in the presence of platinum/tin catalysts to form trans-10-formylpinane. |
| Packaging: | 1, 10 g in glass bottle |
| Symbol |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226 - H304 - H315 - H317 - H410 |
| Precautionary statements | P210 - P273 - P280 - P301 + P310 - P303 + P361 + P353 - P331 |
| Hazard Codes | Xn,N |
| Risk Statements | 10-20/21/22-36/37/38-43-51-65 |
| Safety Statements | 16-26-36/37-46-61-62 |
| RIDADR | UN 2319 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 102.2 °F |
| Flash Point(C) | 39 °C |
| Purity | ≥99% |
| bp | 165-167 °C (lit.) |
| mp | −61 °C (lit.) |
| Density | 0.866 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12352212 |