Nickel(II) bis(2,2,6,6-tetramethyl-3,5-heptanedionate)
ALDRICH/403393 - 97%
Synonym: Ni(TMHD)2
CAS Number: 14481-08-4
Empirical Formula (Hill Notation): C22H38NiO4
Molecular Weight: 425.23
MDL Number: MFCD00192348
Linear Formula: Ni(OCC(CH3)3CHCOC(CH3)3)2
Product Type: Chemical
| assay | 97% |
| form | solid |
| InChI | 1S/2C11H20O2.Ni/c2*1-10(2 |
| InChI key | PIIJAZNTPALBJL-ORWWTJHYSA |
| mp | 219-223 °C (lit.) |
| Quality Level | 100 ![]() |
| reaction suitability | core: nickel |
| SMILES string | CC(C)(C)C(=O)C=C(O[Ni]O |
| Application: | Nickel(II) bis(2,2,6,6-tetramethyl-3 • Metal precursor to for preparation of Ni-based catalysts via Atomic Layer Deposition. |
| General description: | Nickel(II) bis(2,2,6,6-tetramethyl-3 |
| Packaging: | 1 g in glass bottle |
| Symbol | ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302 + H312 + H332 - H350 |
| Precautionary statements | P201 - P280 - P301 + P312 - P302 + P352 + P312 - P304 + P340 + P312 - P308 + P313 |
| Hazard Codes | T |
| Risk Statements | 45-20/21/22 |
| Safety Statements | 53-36/37-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 219-223 °C (lit.) |
| UNSPSC | 12352103 |



