Synonym: (S,S)-2,2′-Isopropylidenebis(4-phenyl-2-oxazoline); (S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane
CAS Number: 131457-46-0
Empirical Formula (Hill Notation): C21H22N2O2
Molecular Weight: 334.41
MDL Number: MFCD00192245
Linear Formula: C21H22N2O2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 405000-1G
| assay |
97% |
| bp |
193 °C/0.03 mmHg (lit.) |
| density |
1 g/mL at 25 °C (lit.) |
| functional group |
ether |
| |
phenyl |
| InChI |
1S/C21H22N2O2/c1-21(2,19-22-17(13-24-19)15-9-5-3-6-10-15)20-23-18(14-25-20)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m1/s1 |
| InChI key |
JTNVCJCSECAMLD-QZTJIDSGSA-N |
| mp |
37-41 °C (lit.) |
| optical activity |
[α]20/D −160°, c = 1 in ethanol |
| Quality Level |
100  |
| SMILES string |
CC(C)(C1=N[C@H](CO1)c2ccccc2)C3=N[C@H](CO3)c4ccccc4 |
| storage temp. |
−20°C |
| Application: |
C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals. |
| Packaging: |
1 g in glass bottle |
| Packaging: |
250 mg in amber glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
230.0 °F - closed cup |
| Flash Point(C) |
110 °C - closed cup |
| Purity |
97% |
| bp |
193 °C/0.03 mmHg (lit.) |
| mp |
37-41 °C (lit.) |
| Density |
1 g/mL at 25 °C (lit.) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352005 |