Poly[(o-cresyl glycidyl ether)-co-formaldehyde]
ALDRICH/405515 - average Mn ~870
Synonym: Formaldehyde, polymer with (chloromethyl)
CAS Number: 29690-82-2
MDL Number: MFCD00192408
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 405515-100G
| density | 1.12 g/mL at 25 °C (lit.) |
| extent of labeling | 5 epoxide functionality |
| form | chunks |
| InChI | 1S/C7H8O.C3H5ClO.CH2O/c1- |
| InChI key | XRYDVSRMOIMZGM-UHFFFAOYSA |
| mol wt | average Mn ~870 |
| mp | 70-75 °C |
| 70-75 °C (lit.) | |
| SMILES string | ClCC2OC2.Oc1c(cccc1)C.O=C |
| transition temp | Tg (DSC) 37-39 °C |
| Tg 37-39 °C (DSC) | |
| viscosity | 35-50 cP(25 °C)(lit.) |
| Application: | For high temperature adhesives, coatings, electrical and laminating products. |
| Application: | Poly[(o-cresyl glycidyl ether)-co-formaldehyde] is an O-cresol formaldehyde based epoxy resin that can be cured using polyethylene amine. It can be used in the formation of abrasion resistant coatings for potential applications in sensors, anti-reflective, electrochromic and antimicrobial coatings. It can also be used in the formation of polyaniline based adhesive for organic electronics. |
| Packaging: | 100 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| mp | 70-75 °C (lit.); 70-75 °C |
| Density | 1.12 g/mL at 25 °C (lit.) |
| UNSPSC | 12162002 |