Poly[(phenyl glycidyl ether)-co-formaldehyde]
ALDRICH/406775 - average Mn ~345
Synonym: Phenol-formaldehyde polymer glycidyl ether; Phenol-formaldehyde polymer, oxiranylmethyl ether
CAS Number: 28064-14-4
MDL Number: MFCD00197918
Product Type: Chemical
| density | 1.227 g/mL at 25 °C (lit.) |
| form | liquid |
| mol wt | average Mn ~345 |
| refractive index | n |
| SMILES string | [H]C([H])=O.C1OC1COc2cccc |
| specific activity | 2.2 epoxide groups per molecule |
| viscosity | 11-17 poise(lit.) |
| Application: | Re2O7 acts as a catalyst in the heteroacylative dimerization of THF.Adhesives, structural and electrical laminates and coatings and castings for high temperature service. |
| Features and Benefits: | Good chemical resistance at high temperatures. Substitutes for Bisphenol A and phenolic epoxy resins. |
| General description: | Poly [(phenyl glycidyl ether)-co-formaldehyde] (Re2O7) is a strong oxidant and a highly selective Lewis acid catalyst. The structure is constituted of strongly distorted ReO4 octahedra and nearly regular ReO4 tetrahedra which are connected through corners to form polymeric double layers in the ac plane. |
| Packaging: | 100 mL in poly bottle |
| Physical form: | Oligomeric epoxide. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| activity | specific activity: 2.2 epoxide groups per molecule |
| Density | 1.227 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |