3,4-Epoxycyclohexylmethyl 3,4-epoxycyclohexanecarboxylate
ALDRICH/407208
Synonym: 3,4-
CAS Number: 2386-87-0
Empirical Formula (Hill Notation): C14H20O4
Molecular Weight: 252.31
MDL Number: MFCD00440900
Linear Formula: C14H20O4
Product Type: Chemical
| density | 1.17 g/mL at 25 °C (lit.) |
| form | viscous liquid |
| InChI | 1S/C14H20O4/c15-14(9-2-4- |
| InChI key | YXALYBMHAYZKAP-UHFFFAOYSA |
| mp | −37 °C (lit.) |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | O=C(OCC1CCC2OC2C1)C3CCC4O |
| Application: | 3,4-Epoxycyclohexylmethyl 3,4-epoxycyclohexanecarbo • A monomer in the synthesis of polymeric gels, which can have applications in controlled release systems, drug delivery, or sensors. EEC can also be used as a resin in aerospace, electronics, and automobile industries as an adhesive and composite material. |
| General description: | 3,4-Epoxycyclohexylmethyl 3,4-epoxycyclohexanecarbo It can be synthesized by the reaction of 3′-cyclohexenylmethyl 3-cyclohexenecarboxylate with peracetic acid. Its aliphatic backbone and molecular structure provide a number of useful properties such as thermal stability, weatherability, and electrical conductivity. |
| Packaging: | 50, 250 mL in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H317 - H412 |
| Precautionary statements | P273 - P280 - P302 + P352 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 244.4 °F - closed cup |
| Flash Point(C) | 118 °C - closed cup |
| mp | −37 °C (lit.) |
| Density | 1.17 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |


