Poly(diallyldimethylammonium chloride) solution
ALDRICH/409030 - average Mw 400,000-500,000 (high molecular weight), 20 wt. % in H2O
Synonym: PDADMAC
CAS Number: 26062-79-3
MDL Number: MFCD00192409
Linear Formula: (C8H16ClN)n
Product Type: Chemical
| concentration | 20 wt. % in H2O |
| density | 1.04 g/mL at 25 °C |
| form | viscous liquid |
| InChI | 1S/C8H16N.ClH/c1-5-7-9(3, |
| InChI key | GQOKIYDTHHZSCJ-UHFFFAOYSA |
| mol wt | average Mw 400,000-500,000 (high molecular weight) |
| Quality Level | 200 ![]() |
| refractive index | n |
| SMILES string | [Cl-].[N+](CC=C)(CC=C)(C) |
| viscosity | 600-900 cP(25 °C) |
| Application: |
|
| General description: | Poly(diallyldimethylammon It is a positively charged polyelectrolyte that finds application in various fields such as paper manufacturing, the mining industry, water treatment, protein immobilization, separation of biomolecules, removal of bacteria, flocculation of silica and latex particles, and nanocapsule shell formation. |
| Packaging: | 1, 4 L in poly bottle |
| Packaging: | 25 mL in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.04 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12162002 |

