3-Nitrophthalonitrile
ALDRICH/411914 - 99%
CAS Number: 51762-67-5
Empirical Formula (Hill Notation): C8H3N3O2
Molecular Weight: 173.13
MDL Number: MFCD00191558
Linear Formula: O2NC6H3(CN)2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 411914-5G
| application(s) | diagnostic assay manufacturing hematology histology |
| assay | 99% |
| form | solid |
| InChI | 1S/C8H3N3O2/c9-4-6-2-1-3- |
| InChI key | UZJZIZFCQFZDHP-UHFFFAOYSA |
| mp | 162-165 °C (lit.) |
| Quality Level | 100  |
| SMILES string | [O-][N+](=O)c1cccc(C#N)c1 |
| storage temp. | room temp |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H315 - H319 - H335 |
| Precautionary statements | P301 + P312 + P330 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 162-165 °C (lit.) |
| Storage Temp. | room temp |
| UNSPSC | 12171500 |