Trimethylolpropane diallyl ether
ALDRICH/416126 - 90%
Synonym: 2,2-
CAS Number: 682-09-7
Empirical Formula (Hill Notation): C12H22O3
Molecular Weight: 214.30
EC Number: 211-661-1
MDL Number: MFCD00035791
Linear Formula: C2H5C(CH2OCH2CH=CH2)2CH2OH
Product Type: Chemical
| assay | 90% |
| bp | 135 °C/13 mmHg (lit.) |
| density | 0.955 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C12H22O3/c1-4-7-14-10- |
| InChI key | BDKDHWOPFRTWPP-UHFFFAOYSA |
| refractive index | n |
| SMILES string | CCC(CO)(COCC=C)COCC=C |
| Application: | TMPAE can be used in the synthesis of isophorone diisocyanate (IPDI) based tetracene monomers which can further be used in the formation of polymer dispersed liquid crystals. It can also be used in the synthesis of allyl ether based dendrimers that find potential usage in coatings. |
| General description: | Trimethylolpropane diallyl ether (TMPAE) is an unsaturated allyl ether that can be synthesized by Williamson esterification reaction in the presence of trimethylolpropane, sodium hydroxide, and allyl chloride as starting materials. |
| Other Notes: | remainder monoethers and triethers |
| Packaging: | 1 L in glass bottle |
| Packaging: | 250 mL in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 244.4 °F - closed cup |
| Flash Point(C) | 118 °C - closed cup |
| Purity | 90% |
| bp | 135 °C/13 mmHg (lit.) |
| Density | 0.955 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |