Synonym: Bis(benzyloxy)(diisopropylamino)phosphine; Dibenzyl N,N-diisopropylphosphoramidate; Dibenzyl diisopropylphosphoramidite; N,N-Diisopropyl dibenzyl phosphoramidate; [Bis(benzyloxy)phosphanyl]bis(propan-2-yl)amine
CAS Number: 108549-23-1
Empirical Formula (Hill Notation): C20H28NO2P
Molecular Weight: 345.42
MDL Number: MFCD00191988
Linear Formula: [(CH3)2CH]2NP(OCH2C6H5)2
Product Type: Chemical
| assay |
90% |
| bp |
130 °C/0.55 mmHg (lit.) |
| density |
1.028 g/mL at 25 °C (lit.) |
| form |
liquid |
| grade |
technical grade |
| InChI |
1S/C20H28NO2P/c1-17(2)21(18(3)4)24(22-15-19-11-7-5-8-12-19)23-16-20-13-9-6-10-14-20/h5-14,17-18H,15-16H2,1-4H3 |
| InChI key |
ANPWLBTUUNFQIO-UHFFFAOYSA-N |
| refractive index |
n20/D 1.535 (lit.) |
| SMILES string |
CC(C)N(C(C)C)P(OCc1ccccc1)OCc2ccccc2 |
| solubility |
acetonitrile: soluble(lit.) |
| |
cold water: insoluble(lit.) |
| |
dichloromethane: soluble(lit.) |
| |
THF: soluble(lit.) |
| storage temp. |
2-8°C |
| Application: |
Dibenzyl N,N-diisopropylphosphoramidite may be used for the preparation of phosphopeptides. It may be used for the synthesis of a GDP (guanosine diphosphate) analog, SML-8-73-1. |
| Packaging: |
5, 25 mL in glass bottle |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26-36 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
156.2 °F - closed cup |
| Flash Point(C) |
69 °C - closed cup |
| Purity |
90% |
| bp |
130 °C/0.55 mmHg (lit.) |
| Density |
1.028 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.535 (lit.) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352100 |
