p-Tolyltrichlorosilane
ALDRICH/419354 - 95%
CAS Number: 701-35-9
Empirical Formula (Hill Notation): C7H7Cl3Si
Molecular Weight: 225.57
EC Number: 211-854-0
MDL Number: MFCD00045131
Linear Formula: CH3C6H4SiCl3
Product Type: Chemical
| assay | 95% |
| bp | 218-220 °C (lit.) |
| density | 1.273 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C7H7Cl3Si/c1-6-2-4-7(5 |
| InChI key | WOMUGKOOLXQCTQ-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | Cc1ccc(cc1)[Si](Cl)(Cl)Cl |
| Application: | Self-assembled monolayers (SAMs) of p-tolyltrichlorosilane (TTCS) were formed on flexible polymer substrates. p-Tolyltrichlorosilane copolymerized with methylphenyldichlorosilan |
| Packaging: | 25 g in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 23-26-27-36/37/39-45 |
| RIDADR | UN 2987 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 210.2 °F - closed cup |
| Flash Point(C) | 99 °C - closed cup |
| Supplemental Hazard Statements | EUH014 |
| Purity | 95% |
| bp | 218-220 °C (lit.) |
| Density | 1.273 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352002 |


