4,5-Dimethoxy-2-nitrobenzyl chloroformate
ALDRICH/420069 - 97%
Synonym: 6-Nitroveratryl chloroformate; 6-
CAS Number: 42855-00-5
Empirical Formula (Hill Notation): C10H10ClNO6
Molecular Weight: 275.64
MDL Number: MFCD00143507
Linear Formula: ClCO2CH2C6H2(OCH3)2NO2
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | 97% |
| form | powder |
| functional group | chloro |
| nitro | |
| InChI | 1S/C10H10ClNO6/c1-16-8-3- |
| InChI key | RWWPKIOWBQFXEE-UHFFFAOYSA |
| mp | 125 °C (dec.) (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | COc1cc(COC(Cl)=O)c(cc1OC) |
| storage temp. | 2-8°C |
| Application: | 4,5-Dimethoxy-2-nitrobenz • Preparation of inactive, caged protein conjugates which can be activated by irradiating near-ultraviolet light. • Solid-phase synthesis of base-sensitive S-acylthioethyl (SATE)-prooligonucleotide • Modification of surface properties by introducing photocleavable NVOC moiety into chitosan to control cell attachment. |
| Packaging: | 1 g in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 125 °C (dec.) (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352101 |


