3,4-Dinitrophenol
ALDRICH/42195 - moistened with water, ≥97.0% (HPLC)
CAS Number: 577-71-9
Empirical Formula (Hill Notation): C6H4N2O5
Molecular Weight: 184.11
EC Number: 209-415-3
MDL Number: MFCD00143065
Linear Formula: C6H4N2O5
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 42195-1G.
| assay | ≥97.0% (HPLC) |
| contains | ~20% water as stabilizer |
| InChI | 1S/C6H4N2O5/c9-4-1-2-5(7( |
| InChI key | AKLOLDQYWQAREW-UHFFFAOYSA |
| mp | 130-135 °C |
| quality | moistened with water |
| SMILES string | Oc1ccc(c(c1)[N+]([O-])=O) |
| solubility | dioxane: soluble 1 g/10 mL |
| General description: | 3,4-Dinitrophenol is a nitrophenol derivative. |
| Packaging: | 1, 5 g in glass bottle |
| Symbol |     GHS01,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H201 - H301 + H311 + H331 - H373 - H411 |
| Precautionary statements | P210 - P230 - P250 - P280 - P301 + P310 - P370 + P372 + P380 + P373 - P503 |
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-33-51/53 |
| Safety Statements | 28-37-45-61 |
| RIDADR | UN1320 - class 4.1 - PG 1 - Dinitrophenol, wetted |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥97.0% (HPLC) |
| mp | 130-135 °C |
| UNSPSC | 12352100 |