DBE-3
ALDRICH/422037
Synonym: Dibasic ester mixture; Mixture of dimethyl adipate and dimethyl glutarate
MDL Number: MFCD00191969
Linear Formula: CH3O2C(CH2)nCO2CH3 (n=3,4)
Product Type: Chemical
| autoignition temp. | 698 °F |
| bp | 215-225 °C (lit.) |
| density | 1.068 g/mL at 25 °C (lit.) |
| description | mixture of dimethyl adipate and dimethyl glutarate |
| expl. lim. | 8 % |
| form | liquid |
| InChI | 1S/C8H14O4.C7H12O4/c1-11- |
| InChI key | FSCIDASGDAWVED-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | COC(=O)CCCC(=O)OC.COC(=O) |
| vapor pressure | 0.2 mmHg ( 20 °C) |
| Legal Information: | Product of Invista |
| Packaging: | 1 L in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 215.6 °F |
| Flash Point(C) | 102 °C |
| bp | 215-225 °C (lit.) |
| Density | 1.068 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |


