Triphenylgermanium hydride
ALDRICH/424838
Synonym: Triphenylgermane; Triphenylgermanyl hydride
CAS Number: 2816-43-5
Empirical Formula (Hill Notation): C18H16Ge
Molecular Weight: 304.96
EC Number: 220-569-0
MDL Number: MFCD00046034
Linear Formula: (C6H5)3GeH
Product Type: Chemical
| form | powder or crystals |
| solid | |
| InChI | 1S/C18H16Ge/c1-4-10-16(11 |
| InChI key | NXHORDQDUDIXOS-UHFFFAOYSA |
| mp | 40-43 °C (lit.) |
| Quality Level | 100 ![]() |
| reaction suitability | core: germanium |
| reagent type: reductant | |
| SMILES string | c1ccc(cc1)[GeH](c2ccccc2) |
| Application: | It may be used in the isomerization of (Z) alkene.1 TEMPO (2,2,6,6-Tetramethylpiper |
| General description: | Triphenylgermanium hydride is a hydrogen donor. |
| Packaging: | 5 g in glass bottle |
| Packaging: | Packaged in glass bottles |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 |
| Precautionary statements | P261 - P264 - P280 - P301 + P312 - P302 + P352 + P312 - P304 + P340 + P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 40-43 °C (lit.) |
| UNSPSC | 12352103 |


