(Heptafluoropropyl)trimethylsilane
ALDRICH/431044 - 97%
Synonym: 1-
CAS Number: 3834-42-2
Empirical Formula (Hill Notation): C6H9F7Si
Molecular Weight: 242.21
MDL Number: MFCD00216712
Linear Formula: CF3CF2CF2Si(CH3)3
Product Type: Chemical
| assay | 97% |
| bp | 88 °C (lit.) |
| density | 1.195 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | fluoro |
| InChI | 1S/C6H9F7Si/c1-14(2,3)6(1 |
| InChI key | PKLASFRWKXWKII-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | C[Si](C)(C)C(F)(F)C(F)(F) |
| Application: | Reactant involved in: • Trifluoromethylation of arenes • Nucleophilic addition followed by intramolecular aza-Michael reactions • Perfluoroalkylation of carbonyl compounds, aldimines and other organic substrates |
| Application: | Used to prepare perfluoroalkyl compounds and heptafluoro-n-propyl derivatives of phosphorus and silicon. |
| Packaging: | 1 g in glass bottle |
| Symbol | GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Risk Statements | 10 |
| Safety Statements | 23-24/25 |
| RIDADR | UN 1993BF 3 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 129.2 °F - closed cup |
| Flash Point(C) | 54 °C - closed cup |
| Purity | 97% |
| bp | 88 °C (lit.) |
| Density | 1.195 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352101 |


