(S)-(−)-3-Boc-2,2-dimethyloxazolidine-4-carboxaldehyde
ALDRICH/432741 - 95%
Synonym: (−)-N-Boc-N,O-isopropylidene-L-serinal; tert-Butyl (S)-(−)-4-formyl-2,2-dimethyl-3-oxazolidinecarboxylate; Garner’s aldehyde
CAS Number: 102308-32-7
Empirical Formula (Hill Notation): C11H19NO4
Molecular Weight: 229.27
MDL Number: MFCD00209557
Linear Formula: C11H19NO4
Product Type: Chemical
| assay | 95% |
| bp | 83-88 °C/1 mmHg (lit.) |
| density | 1.06 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C11H19NO4/c1-10(2,3)16 |
| InChI key | PNJXYVJNOCLJLJ-MRVPVSSYSA |
| optical activity | [α]20/D −90°, c = 1 in chloroform |
| refractive index | n |
| SMILES string | [H]C(=O)[C@@H]1COC(C)(C)N |
| Application: | Widely utilized in the asymmetric synthesis of natural products. |
| Packaging: | 1 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 226.4 °F - closed cup |
| Flash Point(C) | 108 °C - closed cup |
| Purity | 95% |
| bp | 83-88 °C/1 mmHg (lit.) |
| Density | 1.06 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352005 |