Poly(propylene glycol), tolylene 2,4-diisocyanate terminated
ALDRICH/433497 - average Mn ~2,300 (narrow MW distribution), isocyanate ~3.6 wt. %
Synonym: Polypropylene glycol-toluene diisocyanate copolymer; Tolylene diisocyanate-
CAS Number: 9057-91-4
MDL Number: MFCD00217728
Product Type: Chemical
| composition | isocyanate, ~3.6 wt. % |
| density | 1.05 g/mL at 25 °C |
| form | viscous liquid |
| hardness | 80 (Shore A, reacted with MOCA) |
| impurities | <0.1% residual TDI |
| mol wt | average Mn ~2,300 (narrow MW distribution) |
| degree of polymerization ~34 | |
| refractive index | n |
| SMILES string | CC(O)CO.Cc1ccc(cc1N=C=O)N |
| viscosity | ≤1,700 cP(40 °C)(lit.) |
| Application: | Idler rollers and adhesive-handling pads. |
| Features and Benefits: | Lower viscosity than conventional polyurethane oligomers. Aromatic isocyanate is more reactive than aliphatic isocyanate. Aromatic isocyanates are less light stable than aliphatic isocyanates. |
| Packaging: | 250 mL in glass bottle |
| Physical form: | Polyurethane prepolymer. |
| Symbol |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302 + H312 + H332 - H315 - H317 - H319 - H334 - H335 |
| Precautionary statements | P261 - P264 - P280 - P301 + P312 - P302 + P352 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3334 |
| WGK Germany | WGK 3 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Density | 1.05 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12162002 |