Poly(1-vinylpyrrolidone-co-styrene)
ALDRICH/434450 - 38 % emulsion in H2O, <0.5 μm particle size
Synonym: Styrene-N-Vinylpyrrolidone copolymer; Styrene-
CAS Number: 25086-29-7
MDL Number: MFCD00145020
Product Type: Chemical
| composition | styrene, 64 wt. % (dry basis) |
| concentration | 38 % emulsion in H2O |
| density | 1.04 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C8H8.C6H9NO/c1-2-8-6-4 |
| InChI key | ADNXYZUJPHVRPJ-UHFFFAOYSA |
| particle size | <0.5 μm |
| pH | 2-5 |
| Quality Level | 100  |
| SMILES string | N2(CCCC2=O)C=C.c1(ccccc1) |
| viscosity | 200-800 cP(25 °C, Brookfield, spindle #3) (20 rpm)(lit.) |
| Features and Benefits: | Stable, moderately viscous emulsion with high acid and salt tolerance. Forms strong, light-stable films with high water resistance. |
| Packaging: | 1 L in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.04 g/mL at 25 °C (lit.) |
| UNSPSC | 12162002 |