Diethoxy(3-glycidyloxypropyl)methylsilane
ALDRICH/435171 - 97%
Synonym: (3-
CAS Number: 2897-60-1
Empirical Formula (Hill Notation): C11H24O4Si
Molecular Weight: 248.39
EC Number: 220-780-8
MDL Number: MFCD00046995
Linear Formula: C11H24O4Si
Product Type: Chemical
| assay | 97% |
| bp | 122-126 °C/5 mmHg (lit.) |
| density | 0.978 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C11H24O4Si/c1-4-14-16( |
| InChI key | OTARVPUIYXHRRB-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CCO[Si](C)(CCCOCC1CO1)OCC |
| Application: | Coverslips coated with diethoxy(3-glycidyloxypro |
| Application: | GPMS can be used in the surface modification of a variety of particles such as cellulose nanocrystals, silica nanomaterials and other silicon based substrates. It functionalizes these surfaces by attaching the epoxy-silane groups with the surface molecules. |
| General description: | Diethoxy(3-glycidyloxypro |
| Packaging: | 25 mL in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 251.6 °F - closed cup |
| Flash Point(C) | 122 °C - closed cup |
| Purity | 97% |
| bp | 122-126 °C/5 mmHg (lit.) |
| Density | 0.978 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352103 |


