Poly(ethylene glycol) dimethacrylate
ALDRICH/437468 - average Mn 750, contains 900-1100 ppm MEHQ as inhibitor
Synonym: Polyethylene glycol; PEG dimethacrylate
CAS Number: 25852-47-5
MDL Number: MFCD00081877
Linear Formula: C3H5C(O)(OCH2CH2)nOC(O)C3H5
Product Type: Chemical
| Ω-end | methacrylate |
| α-end | methacrylate |
| bp | >200 °C/2 mmHg (lit.) |
| contains | 900-1100 ppm MEHQ as inhibitor |
| density | 1.11 g/mL at 25 °C |
| form | liquid |
| InChI | 1S/C10H14O4/c1-7(2)9(11)1 |
| InChI key | STVZJERGLQHEKB-UHFFFAOYSA |
| mol wt | average Mn 750 |
| polymer architecture | shape : linear functionality : homobifunctional |
| Quality Level | 200 ![]() |
| reaction suitability | reagent type: cross-linking reagent reaction type: Polymerization Reactions |
| refractive index | n |
| SMILES string | OCCO.CC(=C)C(O)=O |
| solubility | H2O: soluble |
| storage temp. | 2-8°C |
| viscosity | 67 cP(25 °C)(lit.) |
| Application: | Adhesives, coatings, sealants, photoresists, solder masks and photopolymers. |
| Features and Benefits: | Contributes flexibility. |
| Packaging: | 1 L in poly bottle |
| Packaging: | 250 mL in poly bottle |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-26-37-60 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| bp | >200 °C/2 mmHg (lit.) |
| Density | 1.11 g/mL at 25 °C |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 12162002 |

