1-Fluoro-2,4,6-trimethylpyridinium tetrafluoroborate
ALDRICH/439312 - ≥95%
Synonym: 1-Fluoro-sym-collidinium tetrafluoroborate
CAS Number: 109705-14-8
Empirical Formula (Hill Notation): C8H11BF5N
Molecular Weight: 226.98
MDL Number: MFCD00153182
Linear Formula: C8H11BF5N
Product Type: Chemical
| assay | ≥95% |
| InChI | 1S/C8H11FN.BF4/c1-6-4-7(2 |
| InChI key | RRNLYYDDEUOXBB-UHFFFAOYSA |
| mp | 213-217 °C (lit.) |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: C-H Activation |
| reagent type: catalyst | |
| reagent type: oxidant reaction type: Fluorinations |
|
| SMILES string | F[B-](F)(F)F.Cc1cc(C)[n+] |
| Application: | A source of electrophilic fluorine, used recently in the synthesis of fluoroazulenes. |
| Application: | Reactant for: • Pd(II)-catalyzed para-selective C-H arylation • Fluorination reactions • Aryl trifluoromethylation reactions |
| Packaging: | 1 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95% |
| mp | 213-217 °C (lit.) |
| UNSPSC | 12352101 |


