N-[3-(Trimethoxysilyl)propyl]aniline
ALDRICH/440809
Synonym: Trimethoxy[3-
CAS Number: 3068-76-6
Empirical Formula (Hill Notation): C12H21NO3Si
Molecular Weight: 255.39
MDL Number: MFCD00053673
Linear Formula: C6H5NH(CH2)3Si(OCH3)3
Product Type: Chemical
| bp | 310 °C (lit.) |
| density | 1.07 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C12H21NO3Si/c1-14-17(1 |
| InChI key | KBJFYLLAMSZSOG-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| refractive index | n |
| SMILES string | CO[Si](CCCNc1ccccc1)(OC)O |
| Application: | TMSPA is a monomer which can be polymerized to form poly(TMPSA). Poly(TMPSA) can be used to coat gold nanorods (AuNRs) to fabricate an electrode for the sensing of hydrogen peroxide. |
| Application: | TMSPA is used as a surface modifying agent that enhances the wettability, dispersion of silica which enhances the anti-degradation in natural rubber (NR). It can be used to functionalize gold nanorods (GNRs) through enzymatic polymerization which may be used for electrochemical detection of hydrogen peroxide (H2O2). It can also be used as an amine based solvent that forms a stable dispersion of single walled carbon nanotubes(SWCNT) after centrifugation. |
| General description: | N-(3-(Trimethoxysilyl)prop |
| General description: | N-[3-(Trimethoxysilyl)prop |
| Packaging: | 50 mL in glass bottle |
| Symbol | ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H314 - H317 - H341 - H351 - H372 - H412 |
| Precautionary statements | P202 - P273 - P280 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 34-40-43-48/20/21/22-68 |
| Safety Statements | 26-35-36/37/39-45 |
| RIDADR | UN 3267 8 / PGII |
| WGK Germany | WGK 2 |
| Flash Point(F) | 230.0 °F - closed cup |
| Flash Point(C) | 110 °C - closed cup |
| bp | 310 °C (lit.) |
| Density | 1.07 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352103 |




