N-Boc-L-prolinol
ALDRICH/446327 - 98%
Synonym: (S)
CAS Number: 69610-40-8
Empirical Formula (Hill Notation): C10H19NO3
Molecular Weight: 201.26
MDL Number: MFCD00066232
Linear Formula: C10H19NO3
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | 98% |
| form | solid |
| InChI | 1S/C10H19NO3/c1-10(2,3)14 |
| InChI key | BFFLLBPMZCIGRM-QMMMGPOBSA |
| mp | 62-64 °C (lit.) |
| optical activity | [α]21/D −48°, c = 1.3 in chloroform |
| reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| SMILES string | CC(C)(C)OC(=O)N1CCC[C@H]1 |
| Application: | Building block for novel nicotinic acetylcholine receptor ligands with cognition-enhancing properties. Used in the synthesis of chiral β-amino sulfides and β-amino thiols. |
| Application: | Used to synthesize anticoagulants. |
| Packaging: | 1, 5 g in glass bottle |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 62-64 °C (lit.) |
| UNSPSC | 12352209 |