Poly(ethylene glycol) methyl ether methacrylate solution
ALDRICH/457876 - average Mn 2,000, 50 wt. % in H2O
Synonym: Polyethylene glycol
CAS Number: 26915-72-0
MDL Number: MFCD00241432
Linear Formula: H2C=C(CH3)CO2(CH2CH2O)nCH3
Product Type: Chemical
| Ω-end | methacrylate |
| α-end | methoxy |
| concentration | 50 wt. % in H2O |
| density | 1.079 g/mL at 25 °C |
| InChI | 1S/C13H24O6/c1-12(2)13(14 |
| InChI key | KRCGBOKYIUDIFY-UHFFFAOYSA |
| mol wt | average Mn 2,000 |
| polymer architecture | shape : linear functionality : monofunctional |
| Quality Level | 200  |
| reaction suitability | reagent type: chemical modification reagent reaction type: Polymerization Reactions |
| refractive index | n |
| SMILES string | COCCOCCOCCOCCOC(=O)C(C)=C |
| Application: | The methacrylate end-group allows for this material to be further polymerized. |
| General description: | Surface grafted polyethylene glycol (PEG) prevents protein absorption. Poly (ethylene glycol) methyl ether methacrylate (m-PEGMA) is often used to create PEG modified surfaces. Studies report the grafting of m-PEGMA on poly ether urethane surface by ozone induced polymerization, on emeraldine film by UV induced copolymerization. |
| Packaging: | 1 L in poly bottle |
| Packaging: | 250 mL in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H317 - H319 - H335 |
| Precautionary statements | P280 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.079 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12162002 |