Synonym: 1-(3-Bromopropyl)-2,2,5,5-tetramethyl-1-aza-2,5-disilacyclopentane
CAS Number: 95091-93-3
Empirical Formula (Hill Notation): C9H22BrNSi2
Molecular Weight: 280.35
MDL Number: MFCD00274342
Linear Formula: C9H22BrNSi2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 459739-5G.
| assay |
97% |
| bp |
80 °C/0.5 mmHg (lit.) |
| density |
1.126 g/mL at 25 °C (lit.) |
| InChI |
1S/C9H22BrNSi2/c1-12(2)8-9-13(3,4)11(12)7-5-6-10/h5-9H2,1-4H3 |
| InChI key |
BKBUBAVZGMRPAK-UHFFFAOYSA-N |
| Quality Level |
200  |
| refractive index |
n20/D 1.484 (lit.) |
| SMILES string |
C[Si]1(C)CC[Si](C)(C)N1CCCBr |
| Application: |
1-(3-Bromopropyl)-2,2,5,5-tetramethyl-1-aza-2,5-disilacyclopentane may be used for the synthesis of PFS-b-PZLys [PFS = Polyferrocenylsilane, PZLys = Poly(epsilon-benzyloxycarbonyl-L-lysine)] block copolymers. |
| Packaging: |
5 g in glass bottle |
| Symbol |
GHS02 |
| Signal word |
Warning |
| Hazard statements |
H226 |
| Risk Statements |
10 |
| Safety Statements |
16 |
| RIDADR |
UN 1993C 3 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
95.0 °F - closed cup |
| Flash Point(C) |
35 °C - closed cup |
| Purity |
97% |
| bp |
80 °C/0.5 mmHg (lit.) |
| Density |
1.126 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.484 (lit.) |
| UNSPSC |
12352100 |