Poly(ethylene glycol) dioleate
ALDRICH/460125 - average Mn ~914
Synonym: O,O′-Dioleoylpolyethylene glycol 400; Polyethylene glycol 400 dioleate
CAS Number: 9005-07-6
MDL Number: MFCD00677733
Linear Formula: CH3(CH2)7CH=CH(CH2)7CO(OCH2CH2)nO2C(CH2)7CH=CH(CH2)7CH3
Product Type: Chemical
| acid number | 4 mg KOH/g |
| bp | >260 °C (lit.) |
| density | 0.945 g/mL at 25 °C (lit.) |
| hydroxyl value | 10 mg KOH/g |
| InChI | 1S/C38H70O4/c1-3-5-7-9-11 |
| InChI key | NKSOSPOXQKNIKJ-CLFAGFIQSA |
| iodine value | 75 |
| mol wt | average Mn ~914 |
| mp | −15 °C (lit.) |
| refractive index | n |
| SMILES string | OCCO.[H]C(CCCCCCCC)=C(/[ |
| solubility | toluene, ethanol and acetone: soluble (dispersible in water) |
| Application: | Plasticizer |
| Packaging: | 100 mL in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| bp | >260 °C (lit.) |
| mp | −15 °C (lit.) |
| Density | 0.945 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |