DAB-Am-4, Polypropylenimine tetramine dendrimer, generation 1
ALDRICH/460699 - volume 428 Å3
Synonym: N,N,N′,N′-Tetrakis(3-aminopropyl)-1,4-butanediamine
CAS Number: 120239-63-6
Empirical Formula (Hill Notation): C16H40N6
Molecular Weight: 316.53
MDL Number: MFCD09264237
Linear Formula: [-CH2CH2N(CH2CH2CH2NH2)2]2
Product Type: Chemical
| density | 0.96 g/mL at 25 °C (lit.) |
| description | aminopropyl surface groups |
| feature | core type 1,4-diaminobutane core (4-carbon core) |
| InChI | 1S/C16H40N6/c17-7-3-13-21 |
| InChI key | LYBWJVKFJAIODE-UHFFFAOYSA |
| mol wt | generation 1 |
| no. Surface Groups | 4 |
| Quality Level | 200 ![]() |
| refractive index | n |
| SMILES string | NCCCN(CCCN)CCCCN(CCCN)CCC |
| solubility | water and methanol: soluble |
| storage temp. | 2-8°C |
| transition temp | Tg 107 °C (pH (25 wt. % aqueous solution) 12.) |
| viscosity | 0.028 poise(50 °C)(lit.) |
| volume | 428 Å3 |
| Application: | Coatings, adhesives, plastic additives, cosmetics, catalysts, conductive films, surfactants, controlled release and medical diagnostics. |
| Packaging: | 5, 25 mL in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735PSN2 8 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | > 230.0 °F - closed cup |
| Flash Point(C) | > 110 °C - closed cup |
| Density | 0.96 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 12162002 |


