Lanthanum(III) oxalate hydrate
ALDRICH/461024 - 99.99% trace metals basis
CAS Number: 79079-18-8
Empirical Formula (Hill Notation): C6La2O12 · xH2O
Molecular Weight: 541.87 (anhydrous basis)
MDL Number: MFCD00150537
Linear Formula: La2(C2O4)3 · xH2O
Product Type: Chemical
| assay | 99.99% trace metals basis |
| form | powder |
| InChI | 1S/3C2H2O4.2La.H2O/c3*3-1 |
| InChI key | KHZAMZAEBBFMFS-UHFFFAOYSA |
| reaction suitability | core: lanthanum |
| reagent type: catalyst | |
| SMILES string | O.O=C1O[La](OC1=O)OC(=O)C |
| Application: | Reagent in a new preparation of single crystal niobium phosphide via a La-Nb-P-O complex intermediate. |
| Packaging: | 25 g in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99.99% trace metals basis |
| UNSPSC | 12352302 |

