Glycolic acid ethoxylate oleyl ether
ALDRICH/463280 - average Mn ~700
Synonym: Oleth-10 carboxylic acid; Oleth-3 carboxylic acid; Oleth-6 carboxylic acid
CAS Number: 57635-48-0
Empirical Formula (Hill Notation): C55H112O8
Molecular Weight: 901.47
MDL Number: MFCD00679048
Linear Formula: CH3(CH2)xCH=CH(CH2)8(OCH2CH2)yOCH2CO2H, x = 5-7, y~2
Product Type: Chemical
| density | 0.99 g/mL at 25 °C |
| impurities | ≤1.5% NaCl |
| 6-10% water | |
| InChI | 1S/C18H36O.C17H34O.C16H32 |
| InChI key | UWYGJWXPMKLMHK-CDQAOSTISA |
| mol wt | average Mn ~700 |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | OCCO.OCC(O)=O.[H]C(CCCCC |
| Application: | Anionic surfactant. Emulsifier for metal-working fluids. |
| Features and Benefits: | Insensitive to hard water. |
| Packaging: | 100 mL in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Density | 0.99 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12162002 |


