Poly(ethylene glycol) behenyl ether methacrylate solution
ALDRICH/468258 - average Mn ~1,500, 50 wt. % in methacrylic acid/water, contains 1000 ppm MEHQ as stabilizer, 25% water
CAS Number: 125441-87-4
MDL Number: MFCD00803835
Linear Formula: H2C=C(CH3)CO2(CH2CH2O)n(CH2)21CH3
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 468258-100ML.
| bp | 95 °C |
| concentration | 50 wt. % in methacrylic acid/water |
| contains | 1000 ppm MEHQ as stabilizer |
| 25% water | |
| density | 1.06 g/mL at 25 °C |
| mol wt | average Mn ~1,500 |
| pH | 3-4 |
| refractive index | n |
| SMILES string | OCCO.CC(=C)C(O)=O.CCCCCCC |
| storage temp. | 2-8°C |
| viscosity | 300 cP(25 °C)(lit.) |
| Application: | Copolymerizable surfactant and associative thickener in acrylic latexes. |
| Packaging: | 100 mL in glass bottle |
| Symbol |    GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302 - H311 - H314 - H334 - H335 |
| Precautionary statements | P261 - P280 - P301 + P312 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 20/21/22-35-37-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN2922 - class 8 - PG 3 - EHS - acidic - Corrosive liquids, toxi |
| WGK Germany | WGK 3 |
| Flash Point(F) | 235.4 °F |
| Flash Point(C) | 113 °C |
| bp | 95 °C |
| Density | 1.06 g/mL at 25 °C |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 12162002 |