Synonym: Nα-Fmoc-Nω-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-L-arginine; Nα-Fmoc-Nω-Pbf-L-arginine
CAS Number: 154445-77-9
Empirical Formula (Hill Notation): C34H40N4O7S
Molecular Weight: 648.77
MDL Number: MFCD00235804
Linear Formula: C34H40N4O7S
Product Type: Chemical
| application(s) |
peptide synthesis |
| assay |
≥98.0% (HPLC) |
| form |
powder or crystals |
| functional group |
Fmoc |
| InChI |
1S/C34H40N4O7S/c1-19-20(2)30(21(3)26-17-34(4,5)45-29(19)26)46(42,43)38-32(35)36-16-10-15-28(31(39)40)37-33(41)44-18-27-24-13-8-6-11-22(24)23-12-7-9-14-25(23)27/h6-9,11-14,27-28H,10,15-18H2,1-5H3,(H,37,41)(H,39,40)(H3,35,36,38)/t28-/m0/s1 |
| InChI key |
HNICLNKVURBTKV-NDEPHWFRSA-N |
| optical activity |
[α]/D -5.5±1.0°, c = 1 in DMF |
| reaction suitability |
reaction type: Fmoc solid-phase peptide synthesis |
| SMILES string |
Cc1c(C)c(c(C)c2CC(C)(C)Oc12)S(=O)(=O)NC(=N)NCCC[C@H](NC(=O)OCC3c4ccccc4-c5ccccc35)C(O)=O |
| storage temp. |
−20°C |
| Application: |
Fmoc-Arg(Pbf)-OH is a Fmoc-protected amino acid derivative that can be used to create arginine-containing peptides. The 2,2,4,6,7-pentamethyIdlhydrobenzofuran-5-sulfonyl group (Pbf) can be easily cleaved by trifluoroacetic acid (TFA). |
| General description: |
Fmoc-Arg(Pbf)-OH is used as a building block in peptide synthesis, providing protection to specific functional groups while allowing for efficient peptide bond formation. |
| Packaging: |
5, 25 g in poly bottle |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352209 |
