Dibutyl itaconate
ALDRICH/476196 - 96%
Synonym: Di(n -butyl) itaconate; Dibutyl itaconate; 2-
CAS Number: 2155-60-4
Empirical Formula (Hill Notation): C13H22O4
Molecular Weight: 242.31
EC Number: 218-451-9
MDL Number: MFCD00027211
Linear Formula: CH3(CH2)3O2CCH2C(=CH2)CO2(CH2)3CH3
Product Type: Chemical
| assay | 96% |
| bp | 284 °C (lit.) |
| density | 0.985 g/mL at 25 °C (lit.) |
| InChI | 1S/C13H22O4/c1-4-6-8-16-1 |
| InChI key | OGVXYCDTRMDYOG-UHFFFAOYSA |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | CCCCOC(=O)CC(=C)C(=O)OCCC |
| Application: | DBI is a monomer that can be copolymerized with pyridine groups to form nanocomposites for the development of bio-based elastomers. Copolymerization of DBI with acrylated epoxidized soya oil (AESO) can produce a thermoset material which finds potential applications in the modification of fatty acids. |
| General description: | Dibutyl itaconate (DBI) is an itaconate ester that can be prepared by an itaconic acid precursor. |
| Packaging: | 500 mL in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 96% |
| bp | 284 °C (lit.) |
| Density | 0.985 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |