2-(2-Ethylhexyloxy)ethanol
ALDRICH/476226 - reagent grade, 97%
Synonym: Ethylene glycol 2-ethylhexyl ether
CAS Number: 1559-35-9
Empirical Formula (Hill Notation): C10H22O2
Molecular Weight: 174.28
EC Number: 216-323-7
MDL Number: MFCD00020602
Linear Formula: CH3(CH2)3CH(C2H5)CH2OCH2CH2OH
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 476226-1L.
| assay | 97% |
| bp | 229 °C (lit.) |
| density | 0.892 g/mL at 25 °C (lit.) |
| grade | reagent grade |
| InChI | 1S/C10H22O2/c1-3-5-6-10(4 |
| InChI key | OHJYHAOODFPJOD-UHFFFAOYSA |
| refractive index | n |
| SMILES string | CCCCC(CC)COCCO |
| Packaging: | 1 L in glass bottle |
| Symbol |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H312 - H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 21-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 228.2 °F - closed cup |
| Flash Point(C) | 109 °C - closed cup |
| Purity | 97% |
| bp | 229 °C (lit.) |
| Density | 0.892 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |