Poly(dimethylsiloxane), monoglycidyl ether terminated
ALDRICH/480290 - average Mn ~5,000
CAS Number: 157723-26-7
MDL Number: MFCD01324983
Linear Formula: Si(CH3)3O[Si(CH3)2O]nSi(CH3)2CH2CH2CH2OCH2(C2H3O)
Product Type: Chemical
| density | 0.97 g/mL at 25 °C (lit.) |
| mol wt | average Mn ~5,000 |
| refractive index | n |
| SMILES string | C[Si](C)(O)O.C[Si](C)(O)C |
| viscosity | ~65 cSt(25 °C)(lit.) |
| Application: | Resin modifier and paint additive. |
| Features and Benefits: | Good lubricating properties. |
| Packaging: | 25 mL in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 0.97 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |