Poly(dimethylsiloxane-co-diphenylsiloxane), divinyl terminated
ALDRICH/482048 - average Mn ~9,300
CAS Number: 68951-96-2
MDL Number: MFCD00240056
Product Type: Chemical
| bp | >400 °C (lit.) |
| density | 1.036 g/mL at 25 °C |
| mol wt | average Mn ~9,300 |
| refractive index | n |
| SMILES string | C[Si](C)=O.C[Si](C)(O)C=C |
| viscosity | ~500 cSt(lit.) |
| General description: | 84:16 mole ratio of dimethylsiloxane:diphenyl |
| Packaging: | 25 mL in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| bp | >400 °C (lit.) |
| Density | 1.036 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12162002 |