Antimony(III) acetate
ALDRICH/483265 - 99.99% trace metals basis
Synonym: Antimony acetate; Antimony triacetate; Triacetoxystibine
CAS Number: 6923-52-0
Empirical Formula (Hill Notation): C6H9O6Sb
Molecular Weight: 298.89
EC Number: 230-043-2
MDL Number: MFCD00014974
Linear Formula: (CH3CO2)3Sb
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 483265-100G
| assay | 99.99% trace metals basis |
| density | 1.22 g/mL at 25 °C (lit.) |
| form | solid |
| InChI | 1S/3C2H4O2.Sb/c3*1-2(3)4; |
| InChI key | JVLRYPRBKSMEBF-UHFFFAOYSA |
| mp | 126-131 °C (lit.) |
| reaction suitability | core: antimony |
| reagent type: catalyst | |
| SMILES string | CC(=O)O[Sb](OC(C)=O)OC(C) |
| Application: | • New Complexes of Antimony(III) with Tridentate O,E,O-Ligands: Explores new antimony(III) complexes providing insights into their bonding and potential applications in materials science (U Böhme, M Herbig, 2023   ).• Antimony (III) acetate as a catalyst for synthesis of xanthenes: Details the use of antimony(III) acetate as a catalyst in the synthesis of biologically active compounds, showcasing its efficiency in organic chemistry (F Hakimi, A Hassanabadi, 2015 ). |
| Packaging: | 100 g in glass bottle |
| Symbol |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 + H332 - H411 |
| Precautionary statements | P273 - P301 + P312 + P330 - P304 + P340 + P312 |
| Hazard Codes | Xn,N |
| Risk Statements | 20/22-51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99.99% trace metals basis |
| mp | 126-131 °C (lit.) |
| Density | 1.22 g/mL at 25 °C (lit.) |
| UNSPSC | 12352103 |