1,4-Phenylenediamine-2,3,5,6-d4
ALDRICH/487473 - 98 atom % D
Synonym: 1,4-Benzene-d4-diamine; 1,4-
Empirical Formula (Hill Notation): C6D4H4N2
Molecular Weight: 112.17
MDL Number: MFCD00190416
Linear Formula: C6D4(NH2)2
Product Type: Chemical
| bp | 267 °C (lit.) |
| form | solid |
| InChI | 1S/C6H8N2/c7-5-1-2-6(8)4- |
| InChI key | CBCKQZAAMUWICA-RHQRLBAQSA |
| isotopic purity | 98 atom % D |
| mass shift | M+4 |
| mp | 143-145 °C (lit.) |
| SMILES string | [2H]c1c([2H])c(N)c([2H])c |
| Packaging: | 1 g in glass bottle |
| Packaging: | This product may be available from bulk stock and can be packaged on demand. For information on pricing, availability and packaging, please contact Stable Isotopes Customer Service  . |
| Symbol |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301 + H311 + H331 - H317 - H319 - H370 - H410 |
| Precautionary statements | P273 - P280 - P301 + P310 + P330 - P302 + P352 + P312 - P304 + P340 + P311 - P305 + P351 + P338 |
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-36-43-48/22-50/53 |
| Safety Statements | 28-36/37-45-60-61 |
| RIDADR | UN 1673 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| bp | 267 °C (lit.) |
| mp | 143-145 °C (lit.) |
| UNSPSC | 12352116 |