3,4-Diacetoxy-1-butene
ALDRICH/488178 - 98%
Synonym: 3-Butene-1,2-diol diacetate; DAcB
CAS Number: 18085-02-4
Empirical Formula (Hill Notation): C8H12O4
Molecular Weight: 172.18
EC Number: 421-720-5
MDL Number: MFCD00143056
Linear Formula: CH3CO2CH2CH(O2CCH3)CH=CH2
Product Type: Chemical
| assay | 98% |
| bp | 95-96 °C/10 mmHg (lit.) |
| density | 1.059 g/mL at 25 °C (lit.) |
| InChI | 1S/C8H12O4/c1-4-8(12-7(3) |
| InChI key | MWWXARALRVYLAE-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CC(=O)OCC(OC(C)=O)C=C |
| General description: | 3,4-Diacetoxy-1-butene (3,4-DAB) is a diacetoxybutene derivative. 1,3-butadiene undergoes oxidative acetoxylation in the presence of palladium-based IMCs (intermetallic compounds) to form 3,4-DAB as one of the product. |
| Packaging: | 10 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| bp | 95-96 °C/10 mmHg (lit.) |
| Density | 1.059 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |


