DL-Nicotine-(methyl-d3)
ALDRICH/489077 - 99 atom % D
CAS Number: 69980-24-1
Empirical Formula (Hill Notation): C10D3H11N2
Molecular Weight: 165.25
MDL Number: MFCD00190489
Linear Formula: C10D3H11N2
Product Type: Chemical
| application(s) | environmental |
| assay | 99% (CP) |
| bp | 247 °C/745 mmHg (lit.) |
| density | 1.029 g/mL at 25 °C (lit.) |
| InChI | 1S/C10H14N2/c1-12-7-3-5-1 |
| InChI key | SNICXCGAKADSCV-FIBGUPNXSA |
| isotopic purity | 99 atom % D |
| mass shift | M+3 |
| Quality Level | 200  |
| refractive index | n |
| SMILES string | [2H]C([2H])([2H])N1CCCC1c |
| storage temp. | −20°C |
| technique(s) | mass spectrometry (MS): suitable |
| Packaging: | 50 mg in ampule |
| Packaging: | This product may be available from bulk stock and can be packaged on demand. For information on pricing, availability and packaging, please contact Stable Isotopes Customer Service . |
| Symbol |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 - H310 |
| Precautionary statements | P262 - P280 - P301 + P310 + P330 - P302 + P352 + P310 |
| Hazard Codes | T+,N |
| Risk Statements | 25-27-51/53 |
| Safety Statements | 36/37-45-61 |
| RIDADR | UN 1654 6.1 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% (CP) |
| bp | 247 °C/745 mmHg (lit.) |
| Density | 1.029 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | −20°C |
| UNSPSC | 12352210 |