2,4,6,8-Tetramethylcyclotetrasiloxane
ALDRICH/512990 - ≥98.5%, ≥99.999% trace metals basis
Synonym: 1,3,5,7-
CAS Number: 2370-88-9
Empirical Formula (Hill Notation): C4H16O4Si4
Molecular Weight: 240.51
EC Number: 219-137-4
MDL Number: MFCD00039567
Linear Formula: (HSiCH3O)4
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 512990-100ML.
| assay | ≥98.5% |
| ≥99.999% trace metals basis | |
| bp | 134 °C (lit.) |
| density | 0.986 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C4H16O4Si4/c1-9-5-10(2 |
| InChI key | BQYPERTZJDZBIR-UHFFFAOYSA |
| mp | −69 °C (lit.) |
| refractive index | n |
| SMILES string | C[SiH]1O[SiH](C)O[SiH](C) |
| storage temp. | 2-8°C |
| Features and Benefits: | Precursor for gate dielectrics in thin-film transistors (TFT), and is a component of photochemically formed SiOX monolayers on TiO. |
| General description: | Atomic number of base material: 14 Silicon |
| Packaging: | 25, 100 mL in glass bottle |
| Symbol |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Risk Statements | 10 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 75.2 °F - closed cup |
| Flash Point(C) | 24 °C - closed cup |
| Purity | ≥98.5%; ≥99.999% trace metals basis |
| bp | 134 °C (lit.) |
| mp | −69 °C (lit.) |
| Density | 0.986 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352103 |