Bis(2-ethylhexyl) adipate
ALDRICH/525197 - 99%
Synonym: Adipic acid di(2-ethylhexyl) ester; DOA
CAS Number: 103-23-1
Empirical Formula (Hill Notation): C22H42O4
Molecular Weight: 370.57
EC Number: 203-090-1
MDL Number: MFCD00009496
Linear Formula: [-CH2CH2CO2CH2CH(C2H5)(CH2)3CH3]2
Product Type: Chemical
| assay | 99% |
| bp | 175 °C/2 mmHg (lit.) |
| density | 0.925 g/mL at 20 °C (lit.) |
| InChI | 1S/C22H42O4/c1-5-9-13-19( |
| InChI key | SAOKZLXYCUGLFA-UHFFFAOYSA |
| mp | <−70 °C (lit.) |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CCCCC(CC)COC(=O)CCCCC(=O) |
| Application: | Plasticizer |
| General description: | Bis(2-ethylhexyl) adipate (Bis(2-ethylhexyl) phthalate (DEHP)), is an ester of adipic acid and 2-ethylhexanol. It is a plasticizer and finds application in plastic technology, in order to impart flexibility to rigid polymers. It is an indirect food additive formed due to contact of adhesives with polymers. |
| Packaging: | 1 L in glass bottle |
| Packaging: | 5 mL in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 384.8 °F - closed cup |
| Flash Point(C) | 196 °C - closed cup |
| Purity | 99% |
| bp | 175 °C/2 mmHg (lit.) |
| mp | <−70 °C (lit.) |
| Density | 0.925 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 26111700 |

