Poly(sodium 4-styrenesulfonate) solution
ALDRICH/527483 - average Mw ~70,000, 30 wt. % in H2O
Synonym: PSS; Poly(4-
CAS Number: 25704-18-1
MDL Number: MFCD00084449
Linear Formula: (C8H7NaO3S)n
Product Type: Chemical
| bp | 100 °C |
| concentration | 30 wt. % in H2O |
| density | 1.158 g/mL at 25 °C |
| InChI | 1S/C8H8O3S/c1-2-7-3-5-8(6 |
| InChI key | MAGFQRLKWCCTQJ-UHFFFAOYSA |
| mol wt | average Mw ~70,000 |
| Quality Level | 200 ![]() |
| refractive index | n |
| SMILES string | [S](=O)(=O)(O)c1ccc(cc1)C |
| Application: | Effective antistatic and specialty dispersant. |
| Features and Benefits: | Anionic polyelectrolyte |
| Packaging: | 1 L in poly bottle |
| Packaging: | 100 mL in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| bp | 100 °C |
| Density | 1.158 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12162002 |

