N-Hydroxynaphthalimide triflate
ALDRICH/531081 - electronic grade, ≥99%
Synonym: N-Hydroxynaphthalimide trifluoromethanesulfonate; HNT; NHN-TF
CAS Number: 85342-62-7
Empirical Formula (Hill Notation): C13H6F3NO5S
Molecular Weight: 345.25
MDL Number: MFCD02683478
Linear Formula: C13H6F3NO5S
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 531081-1G
This image depicts SKU: 531081-1G
| assay | ≥99% |
| grade | electronic grade |
| InChI | 1S/C13H6F3NO5S/c14-13(15, |
| InChI key | LWHOMMCIJIJIGV-UHFFFAOYSA |
| mp | 212.1-214.2 °C |
| SMILES string | FC(F)(F)S(=O)(=O)ON1C(=O) |
| solubility | γ-butyrolactone: ~2% |
| ethyl lactate: <1% | |
| PGMEA: 1% |
| Application: | HNT can be used to form patterned nanoparticles that find potential applications in volumetric manufacturing of semiconductor devices. It can also be used in the photo-responsive pore reopening of zeolites that facilitates the regulation of the gas permeation process. UV-irradiated trimethylsilyl ultrathin cellulose based films can be formed in presence of HNT as a PAG. |
| General description: | N-Hydroxynaphthalimide triflate (HNT) is a photoacid generator(PAG) that forms an acid upon exposure to UV light which can be used to generate patterned structures. It can also be used to tune the solubility of a polymer by forming acid linkages. |
| Packaging: | 1 g in amber poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99% |
| mp | 212.1-214.2 °C |
| UNSPSC | 12352300 |