p-Toluenesulfonyl hydrazide, polymer-bound
ALDRICH/532339 - 100-200 mesh, extent of labeling: 1.0-2.0 mmol/g loading, 1 % cross-linked with divinylbenzene
Synonym: Polystyrene sulfonyl hydrazide resin
MDL Number: MFCD02683443
Product Type: Chemical
| crosslinking | 1 % cross-linked with divinylbenzene |
| extent of labeling | 1.0-2.0 mmol/g loading |
| functional group | hydrazine |
| particle size | 100-200 mesh |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: solution phase peptide synthesis |
| SMILES string | [X]Cc1ccc(cc1)[S](=O)(=O) |
| Packaging: | 5, 25, 100 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12352125 |

