2,3,4,5,6-Pentafluorobenzylzinc bromide solution
ALDRICH/541273 - 0.5 M in THF
CAS Number: 352534-75-9
Empirical Formula (Hill Notation): C7H2BrF5Zn
Molecular Weight: 326.38
MDL Number: MFCD01311425
Linear Formula: C6F5CH2ZnBr
Product Type: Chemical
| bp | 65 °C |
| concentration | 0.5 M in THF |
| density | 1.018 g/mL at 25 °C |
| functional group | fluoro |
| InChI | 1S/C7H2F5.BrH.Zn/c1-2-3(8 |
| InChI key | WAKJCJJTVRCONB-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | Fc1c(F)c(F)c(C[Zn]Br)c(F) |
| storage temp. | 2-8°C |
| Legal Information: | Product of Rieke ® Metals, Inc. ®Registered trademark of Rieke Metals, Inc. |
| Packaging: | 50 mL in Sure/Seal™ |
| Symbol | ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225 - H302 - H319 - H335 - H351 |
| Precautionary statements | P210 - P280 - P301 + P312 + P330 - P305 + P351 + P338 - P370 + P378 - P403 + P235 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-19-36/37-40 |
| Safety Statements | 16-26-36/37 |
| RIDADR | UN 2056 3 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 62.6 °F - closed cup |
| Flash Point(C) | 17 °C - closed cup |
| Supplemental Hazard Statements | EUH019 |
| bp | 65 °C |
| Density | 1.018 g/mL at 25 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352103 |




