AmberLite™ MAC-3 H Cation Exchange Resin
ALDRICH/546976 - hydrogen form
CAS Number: 9052-45-3
MDL Number: MFCD03098973
Product Type: Chemical
This image is provided for informative purposes only and does not represent an actual product label. It should not be used as a substitute for official product labeling.
| capacity | 3.8 meq/mL by wetted bed volume |
| form | beads |
| InChI | 1S/C10H10.C3H4O2/c1-3-9-7 |
| InChI key | TXDYWJDYXZCRAN-UHFFFAOYSA |
| matrix | acrylic polymer (macroporous) |
| matrix active group | carboxylic acid |
| moisture | 44-52% |
| operating pH | 4-14 |
| parameter | 120 °C max. temp. |
| particle size | 12-50 mesh |
| 300-1200 μm | |
| separation technique | cation exchange |
| SMILES string | OC(=O)C=C.c1(c(cccc1)C=C) |
| technique(s) | LPLC: suitable |
| Application: | Dowex MAC-3 was used in the separation and pre-concentration of metal ions in alcohol. It was also used as packaging material in chromatographic columns for purification. |
| Application: | Weakly acidic cation exchanger for water treatment, dealkalization, purification of antibiotics, pharmaceuticals and amino acids, etc. The macroporous matrix gives the resin good resistance to osmotic shock, while maintaining a high regeneration efficiency. |
| General description: | Dowex MAC-3 contains carboxylic acid as functional group and is selective for Cu and Fe. The resin has larger exchange capacity and large particle size. |
| Legal Information: | Amberlite is a trademark of DuPont de Nemours, Inc. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 250 g in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 23151817 |