Dibenz [b,f]azepine-5-carbonyl chloride
ALDRICH/548644 - 90%
CAS Number: 33948-22-0
Empirical Formula (Hill Notation): C15H10ClNO
Molecular Weight: 255.70
MDL Number: MFCD00792462
Linear Formula: C15H10ClNO
Product Type: Chemical
| assay | 90% |
| functional group | chloro |
| InChI | 1S/C15H10ClNO/c16-15(18)1 |
| InChI key | APJYHXJGXDPGBA-UHFFFAOYSA |
| mp | 149-153 °C (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | ClC(=O)N1c2ccccc2C=Cc3ccc |
| Application: | Dibenz [b,f]azepine-5-carbonyl chloride may be used in the preparation of trans-10,11-dibromo-10,11-dihy |
| General description: | Dibenz [b,f]azepine-5-carbonyl chloride or 5H-dibenz [b,f]azepine-5-carbonyl chloride is a tricyclic heterocyclic compound that can be synthesized from 5H-dibenz[ b,f]azepine. |
| Packaging: | 5 g in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 90% |
| mp | 149-153 °C (lit.) |
| UNSPSC | 12352100 |


